C28H44N4O3S — CID 153335967
tert-butyl 4-[3-[(6-aminosulfanyl-5-phenylmethoxy-2-pyridinyl)amino]propyl]-2,2-dimethylpyrrolidine-1-carboxylate;ethane (PubChem CID 153335967) has the molecular formula C28H44N4O3S and a molecular weight of 516.75 g/mol. Its IUPAC name is tert-butyl 4-[3-[(6-aminosulfanyl-5-phenylmethoxy-2-pyridinyl)amino]propyl]-2,2-dimethylpyrrolidine-1-carboxylate;ethane.
| Compound Name | tert-butyl 4-[3-[(6-aminosulfanyl-5-phenylmethoxy-2-pyridinyl)amino]propyl]-2,2-dimethylpyrrolidine-1-carboxylate;ethane |
|---|---|
| PubChem CID | 153335967 |
| Molecular Formula | C28H44N4O3S |
| Molecular Weight | 516.75 g/mol |
| Exact Mass | 516.31 |
| IUPAC Name | tert-butyl 4-[3-[(6-aminosulfanyl-5-phenylmethoxy-2-pyridinyl)amino]propyl]-2,2-dimethylpyrrolidine-1-carboxylate;ethane |
| SMILES | CC.CC(C)(C)OC(=O)N1CC(CCCNc2ccc(OCc3ccccc3)c(SN)n2)CC1(C)C |
| InChI | InChI=1S/C26H38N4O3S.C2H6/c1-25(2,3)33-24(31)30-17-20(16-26(30,4)5)12-9-15-28-22-14-13-21(23(29-22)34-27)32-18-19-10-7-6-8-11-19;1-2/h6-8,10-11,13-14,20H,9,12,15-18,27H2,1-5H3,(H,28,29);1-2H3 |
| InChIKey | LAPMQAGOTBPALN-UHFFFAOYSA-N |
| XLogP | 6.88 |
| TPSA | 89.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.75 |
| LogP ≤ 5 | 6.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|