C25H36N4O2S — CID 156639038
tert-butyl 4-[3-[(6-aminosulfanyl-2-pyridinyl)amino]propyl]-2-benzyl-2-methylpyrrolidine-1-carboxylate (PubChem CID 156639038) has the molecular formula C25H36N4O2S and a molecular weight of 456.66 g/mol. Its IUPAC name is tert-butyl 4-[3-[(6-aminosulfanyl-2-pyridinyl)amino]propyl]-2-benzyl-2-methylpyrrolidine-1-carboxylate.
| Compound Name | tert-butyl 4-[3-[(6-aminosulfanyl-2-pyridinyl)amino]propyl]-2-benzyl-2-methylpyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 156639038 |
| Molecular Formula | C25H36N4O2S |
| Molecular Weight | 456.66 g/mol |
| Exact Mass | 456.26 |
| IUPAC Name | tert-butyl 4-[3-[(6-aminosulfanyl-2-pyridinyl)amino]propyl]-2-benzyl-2-methylpyrrolidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CC(CCCNc2cccc(SN)n2)CC1(C)Cc1ccccc1 |
| InChI | InChI=1S/C25H36N4O2S/c1-24(2,3)31-23(30)29-18-20(17-25(29,4)16-19-10-6-5-7-11-19)12-9-15-27-21-13-8-14-22(28-21)32-26/h5-8,10-11,13-14,20H,9,12,15-18,26H2,1-4H3,(H,27,28) |
| InChIKey | RTPYNJBFKUAYTE-UHFFFAOYSA-N |
| XLogP | 5.50 |
| TPSA | 80.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.66 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|