C22H42N4O2S — CID 156639423
4-[3-[(6-aminosulfanyl-2-pyridinyl)amino]propyl]-2,2-dimethylpyrrolidine-1-carbaldehyde;ethane;2-methoxy-2-methylpropane (PubChem CID 156639423) has the molecular formula C22H42N4O2S and a molecular weight of 426.67 g/mol. Its IUPAC name is 4-[3-[(6-aminosulfanyl-2-pyridinyl)amino]propyl]-2,2-dimethylpyrrolidine-1-carbaldehyde;ethane;2-methoxy-2-methylpropane.
| Compound Name | 4-[3-[(6-aminosulfanyl-2-pyridinyl)amino]propyl]-2,2-dimethylpyrrolidine-1-carbaldehyde;ethane;2-methoxy-2-methylpropane |
|---|---|
| PubChem CID | 156639423 |
| Molecular Formula | C22H42N4O2S |
| Molecular Weight | 426.67 g/mol |
| Exact Mass | 426.30 |
| IUPAC Name | 4-[3-[(6-aminosulfanyl-2-pyridinyl)amino]propyl]-2,2-dimethylpyrrolidine-1-carbaldehyde;ethane;2-methoxy-2-methylpropane |
| SMILES | CC.CC1(C)CC(CCCNc2cccc(SN)n2)CN1C=O.COC(C)(C)C |
| InChI | InChI=1S/C15H24N4OS.C5H12O.C2H6/c1-15(2)9-12(10-19(15)11-20)5-4-8-17-13-6-3-7-14(18-13)21-16;1-5(2,3)6-4;1-2/h3,6-7,11-12H,4-5,8-10,16H2,1-2H3,(H,17,18);1-4H3;1-2H3 |
| InChIKey | BSPDYCPTMHEPEA-UHFFFAOYSA-N |
| XLogP | 4.95 |
| TPSA | 80.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.67 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|