C30H40ClN5O4S — CID 139428875
tert-butyl 4-[3-[[6-[[2-chloro-6-(3,4-dihydro-2H-pyran-6-yl)pyridine-3-carbonyl]amino]sulfanyl-2-pyridinyl]amino]propyl]-2,2-dimethylpyrrolidine-1-carboxylate (PubChem CID 139428875) has the molecular formula C30H40ClN5O4S and a molecular weight of 602.20 g/mol. Its IUPAC name is tert-butyl 4-[3-[[6-[[2-chloro-6-(3,4-dihydro-2H-pyran-6-yl)pyridine-3-carbonyl]amino]sulfanyl-2-pyridinyl]amino]propyl]-2,2-dimethylpyrrolidine-1-carboxylate.
| Compound Name | tert-butyl 4-[3-[[6-[[2-chloro-6-(3,4-dihydro-2H-pyran-6-yl)pyridine-3-carbonyl]amino]sulfanyl-2-pyridinyl]amino]propyl]-2,2-dimethylpyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 139428875 |
| Molecular Formula | C30H40ClN5O4S |
| Molecular Weight | 602.20 g/mol |
| Exact Mass | 601.25 |
| IUPAC Name | tert-butyl 4-[3-[[6-[[2-chloro-6-(3,4-dihydro-2H-pyran-6-yl)pyridine-3-carbonyl]amino]sulfanyl-2-pyridinyl]amino]propyl]-2,2-dimethylpyrrolidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CC(CCCNc2cccc(SNC(=O)c3ccc(C4=CCCCO4)nc3Cl)n2)CC1(C)C |
| InChI | InChI=1S/C30H40ClN5O4S/c1-29(2,3)40-28(38)36-19-20(18-30(36,4)5)10-9-16-32-24-12-8-13-25(34-24)41-35-27(37)21-14-15-22(33-26(21)31)23-11-6-7-17-39-23/h8,11-15,20H,6-7,9-10,16-19H2,1-5H3,(H,32,34)(H,35,37) |
| InChIKey | SEIBLYDQUAYZEB-UHFFFAOYSA-N |
| XLogP | 6.95 |
| TPSA | 105.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 602.20 |
| LogP ≤ 5 | 6.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|