C20H37N5O3S2 — CID 153336146
tert-butyl 4-[3-[[6-[amino(methyl)amino]sulfanyloxy-2-pyridinyl]amino]propyl]-2,2-dimethylpyrrolidine-1-carboxylate;sulfane (PubChem CID 153336146) has the molecular formula C20H37N5O3S2 and a molecular weight of 459.68 g/mol. Its IUPAC name is tert-butyl 4-[3-[[6-[amino(methyl)amino]sulfanyloxy-2-pyridinyl]amino]propyl]-2,2-dimethylpyrrolidine-1-carboxylate;sulfane.
| Compound Name | tert-butyl 4-[3-[[6-[amino(methyl)amino]sulfanyloxy-2-pyridinyl]amino]propyl]-2,2-dimethylpyrrolidine-1-carboxylate;sulfane |
|---|---|
| PubChem CID | 153336146 |
| Molecular Formula | C20H37N5O3S2 |
| Molecular Weight | 459.68 g/mol |
| Exact Mass | 459.23 |
| IUPAC Name | tert-butyl 4-[3-[[6-[amino(methyl)amino]sulfanyloxy-2-pyridinyl]amino]propyl]-2,2-dimethylpyrrolidine-1-carboxylate;sulfane |
| SMILES | CN(N)SOc1cccc(NCCCC2CN(C(=O)OC(C)(C)C)C(C)(C)C2)n1.S |
| InChI | InChI=1S/C20H35N5O3S.H2S/c1-19(2,3)27-18(26)25-14-15(13-20(25,4)5)9-8-12-22-16-10-7-11-17(23-16)28-29-24(6)21;/h7,10-11,15H,8-9,12-14,21H2,1-6H3,(H,22,23);1H2 |
| InChIKey | RBGBVVDDVPEKCD-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 92.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.68 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|