C18H32N4O2S — CID 139428627
tert-butyl 4-[4-(3-aminosulfanylpyrazol-1-yl)butyl]-2,2-dimethylpyrrolidine-1-carboxylate (PubChem CID 139428627) has the molecular formula C18H32N4O2S and a molecular weight of 368.55 g/mol. Its IUPAC name is tert-butyl 4-[4-(3-aminosulfanylpyrazol-1-yl)butyl]-2,2-dimethylpyrrolidine-1-carboxylate.
| Compound Name | tert-butyl 4-[4-(3-aminosulfanylpyrazol-1-yl)butyl]-2,2-dimethylpyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 139428627 |
| Molecular Formula | C18H32N4O2S |
| Molecular Weight | 368.55 g/mol |
| Exact Mass | 368.22 |
| IUPAC Name | tert-butyl 4-[4-(3-aminosulfanylpyrazol-1-yl)butyl]-2,2-dimethylpyrrolidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CC(CCCCn2ccc(SN)n2)CC1(C)C |
| InChI | InChI=1S/C18H32N4O2S/c1-17(2,3)24-16(23)22-13-14(12-18(22,4)5)8-6-7-10-21-11-9-15(20-21)25-19/h9,11,14H,6-8,10,12-13,19H2,1-5H3 |
| InChIKey | HKMWFQQUNBJDNF-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 73.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.55 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|