C21H35N3O2S — CID 139428386
tert-butyl 4-[5-(5-aminosulfanyl-2-pyridinyl)pentyl]-2,2-dimethylpyrrolidine-1-carboxylate (PubChem CID 139428386) has the molecular formula C21H35N3O2S and a molecular weight of 393.60 g/mol. Its IUPAC name is tert-butyl 4-[5-(5-aminosulfanyl-2-pyridinyl)pentyl]-2,2-dimethylpyrrolidine-1-carboxylate.
| Compound Name | tert-butyl 4-[5-(5-aminosulfanyl-2-pyridinyl)pentyl]-2,2-dimethylpyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 139428386 |
| Molecular Formula | C21H35N3O2S |
| Molecular Weight | 393.60 g/mol |
| Exact Mass | 393.24 |
| IUPAC Name | tert-butyl 4-[5-(5-aminosulfanyl-2-pyridinyl)pentyl]-2,2-dimethylpyrrolidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CC(CCCCCc2ccc(SN)cn2)CC1(C)C |
| InChI | InChI=1S/C21H35N3O2S/c1-20(2,3)26-19(25)24-15-16(13-21(24,4)5)9-7-6-8-10-17-11-12-18(27-22)14-23-17/h11-12,14,16H,6-10,13,15,22H2,1-5H3 |
| InChIKey | NTGHVHOZJMXYRS-UHFFFAOYSA-N |
| XLogP | 5.19 |
| TPSA | 68.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.60 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|