C19H30BN3O2 — CID 156639620
CID 156639620 (PubChem CID 156639620) has the molecular formula C19H30BN3O2 and a molecular weight of 343.28 g/mol.
| Compound Name | CID 156639620 |
|---|---|
| PubChem CID | 156639620 |
| Molecular Formula | C19H30BN3O2 |
| Molecular Weight | 343.28 g/mol |
| Exact Mass | 343.24 |
| IUPAC Name | — |
| SMILES | [B]c1ccc(C(N)CCC2CN(C(=O)OC(C)(C)C)C(C)(C)C2)nc1 |
| InChI | InChI=1S/C19H30BN3O2/c1-18(2,3)25-17(24)23-12-13(10-19(23,4)5)6-8-15(21)16-9-7-14(20)11-22-16/h7,9,11,13,15H,6,8,10,12,21H2,1-5H3 |
| InChIKey | PJUMITOGBFSIBF-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 68.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.28 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|