C30H58N4O8 — CID 175729197
bis(tert-butyl (4S)-4-(3-aminopropyl)-2,2-dimethylpyrrolidine-1-carboxylate);oxalic acid (PubChem CID 175729197) has the molecular formula C30H58N4O8 and a molecular weight of 602.81 g/mol. Its IUPAC name is bis(tert-butyl (4S)-4-(3-aminopropyl)-2,2-dimethylpyrrolidine-1-carboxylate);oxalic acid.
| Compound Name | bis(tert-butyl (4S)-4-(3-aminopropyl)-2,2-dimethylpyrrolidine-1-carboxylate);oxalic acid |
|---|---|
| PubChem CID | 175729197 |
| Molecular Formula | C30H58N4O8 |
| Molecular Weight | 602.81 g/mol |
| Exact Mass | 602.43 |
| IUPAC Name | bis(tert-butyl (4S)-4-(3-aminopropyl)-2,2-dimethylpyrrolidine-1-carboxylate);oxalic acid |
| SMILES | CC(C)(C)OC(=O)N1C[C@@H](CCCN)CC1(C)C.CC(C)(C)OC(=O)N1C[C@@H](CCCN)CC1(C)C.O=C(O)C(=O)O |
| InChI | InChI=1S/2C14H28N2O2.C2H2O4/c2*1-13(2,3)18-12(17)16-10-11(7-6-8-15)9-14(16,4)5;3-1(4)2(5)6/h2*11H,6-10,15H2,1-5H3;(H,3,4)(H,5,6)/t2*11-;/m00./s1 |
| InChIKey | VKLOAJFXQHKSJG-ISAZSYCMSA-N |
| XLogP | 4.68 |
| TPSA | 185.72 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 602.81 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|