C33H40BN7O6S — CID 174029061
CID 174029061 (PubChem CID 174029061) has the molecular formula C33H40BN7O6S and a molecular weight of 673.61 g/mol.
| Compound Name | CID 174029061 |
|---|---|
| PubChem CID | 174029061 |
| Molecular Formula | C33H40BN7O6S |
| Molecular Weight | 673.61 g/mol |
| Exact Mass | 673.29 |
| IUPAC Name | — |
| SMILES | [B]C(O)(C1C2(CC2)C12CC2)C(O)(O)Oc1ccn(-c2ccc(C(=O)NSc3cccc(NCCCC4CN(C=O)C(C)(C)C4)n3)cn2)n1 |
| InChI | InChI=1S/C33H40BN7O6S/c1-29(2)17-21(19-40(29)20-42)5-4-15-35-23-6-3-7-26(37-23)48-39-27(43)22-8-9-24(36-18-22)41-16-10-25(38-41)47-33(45,46)32(34,44)28-30(11-12-30)31(28)13-14-31/h3,6-10,16,18,20-21,28,44-46H,4-5,11-15,17,19H2,1-2H3,(H,35,37)(H,39,43) |
| InChIKey | SNGLELDHABAYSZ-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 174.96 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 673.61 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|