C20H34N4O2S — CID 139428361
tert-butyl 5-[4-[(6-aminosulfanyl-2-pyridinyl)amino]butyl]-2,2-dimethylpyrrolidine-1-carboxylate (PubChem CID 139428361) has the molecular formula C20H34N4O2S and a molecular weight of 394.59 g/mol. Its IUPAC name is tert-butyl 5-[4-[(6-aminosulfanyl-2-pyridinyl)amino]butyl]-2,2-dimethylpyrrolidine-1-carboxylate.
| Compound Name | tert-butyl 5-[4-[(6-aminosulfanyl-2-pyridinyl)amino]butyl]-2,2-dimethylpyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 139428361 |
| Molecular Formula | C20H34N4O2S |
| Molecular Weight | 394.59 g/mol |
| Exact Mass | 394.24 |
| IUPAC Name | tert-butyl 5-[4-[(6-aminosulfanyl-2-pyridinyl)amino]butyl]-2,2-dimethylpyrrolidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1C(CCCCNc2cccc(SN)n2)CCC1(C)C |
| InChI | InChI=1S/C20H34N4O2S/c1-19(2,3)26-18(25)24-15(12-13-20(24,4)5)9-6-7-14-22-16-10-8-11-17(23-16)27-21/h8,10-11,15H,6-7,9,12-14,21H2,1-5H3,(H,22,23) |
| InChIKey | PCTBADNPAJNSBV-UHFFFAOYSA-N |
| XLogP | 4.81 |
| TPSA | 80.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.59 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|