C15H24N4O4S — CID 139416373
(5S)-2,2-dimethyl-5-[3-[(6-sulfamoyl-2-pyridinyl)amino]propyl]pyrrolidine-1-carboxylic acid (PubChem CID 139416373) has the molecular formula C15H24N4O4S and a molecular weight of 356.45 g/mol. Its IUPAC name is (5S)-2,2-dimethyl-5-[3-[(6-sulfamoyl-2-pyridinyl)amino]propyl]pyrrolidine-1-carboxylic acid.
| Compound Name | (5S)-2,2-dimethyl-5-[3-[(6-sulfamoyl-2-pyridinyl)amino]propyl]pyrrolidine-1-carboxylic acid |
|---|---|
| PubChem CID | 139416373 |
| Molecular Formula | C15H24N4O4S |
| Molecular Weight | 356.45 g/mol |
| Exact Mass | 356.15 |
| IUPAC Name | (5S)-2,2-dimethyl-5-[3-[(6-sulfamoyl-2-pyridinyl)amino]propyl]pyrrolidine-1-carboxylic acid |
| SMILES | CC1(C)CC[C@H](CCCNc2cccc(S(N)(=O)=O)n2)N1C(=O)O |
| InChI | InChI=1S/C15H24N4O4S/c1-15(2)9-8-11(19(15)14(20)21)5-4-10-17-12-6-3-7-13(18-12)24(16,22)23/h3,6-7,11H,4-5,8-10H2,1-2H3,(H,17,18)(H,20,21)(H2,16,22,23)/t11-/m0/s1 |
| InChIKey | LHHMXNGLCIYHNQ-NSHDSACASA-N |
| XLogP | 1.84 |
| TPSA | 125.62 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.45 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|