C17H26N2O5S — CID 139389459
2,2-dimethyl-4-[4-(4-sulfamoylphenoxy)butyl]pyrrolidine-1-carboxylic acid (PubChem CID 139389459) has the molecular formula C17H26N2O5S and a molecular weight of 370.47 g/mol. Its IUPAC name is 2,2-dimethyl-4-[4-(4-sulfamoylphenoxy)butyl]pyrrolidine-1-carboxylic acid.
| Compound Name | 2,2-dimethyl-4-[4-(4-sulfamoylphenoxy)butyl]pyrrolidine-1-carboxylic acid |
|---|---|
| PubChem CID | 139389459 |
| Molecular Formula | C17H26N2O5S |
| Molecular Weight | 370.47 g/mol |
| Exact Mass | 370.16 |
| IUPAC Name | 2,2-dimethyl-4-[4-(4-sulfamoylphenoxy)butyl]pyrrolidine-1-carboxylic acid |
| SMILES | CC1(C)CC(CCCCOc2ccc(S(N)(=O)=O)cc2)CN1C(=O)O |
| InChI | InChI=1S/C17H26N2O5S/c1-17(2)11-13(12-19(17)16(20)21)5-3-4-10-24-14-6-8-15(9-7-14)25(18,22)23/h6-9,13H,3-5,10-12H2,1-2H3,(H,20,21)(H2,18,22,23) |
| InChIKey | BENXMMLEUZWRRA-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 109.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.47 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|