C24H26F2N6O — CID 139390194
N-[5-fluoro-4-[8-fluoro-4-(2-methylpropyl)-2,3-dihydro-1,4-benzoxazin-6-yl]pyrimidin-2-yl]-5,6,7,8-tetrahydro-1,6-naphthyridin-2-amine (PubChem CID 139390194) has the molecular formula C24H26F2N6O and a molecular weight of 452.51 g/mol. Its IUPAC name is N-[5-fluoro-4-[8-fluoro-4-(2-methylpropyl)-2,3-dihydro-1,4-benzoxazin-6-yl]pyrimidin-2-yl]-5,6,7,8-tetrahydro-1,6-naphthyridin-2-amine.
| Compound Name | N-[5-fluoro-4-[8-fluoro-4-(2-methylpropyl)-2,3-dihydro-1,4-benzoxazin-6-yl]pyrimidin-2-yl]-5,6,7,8-tetrahydro-1,6-naphthyridin-2-amine |
|---|---|
| PubChem CID | 139390194 |
| Molecular Formula | C24H26F2N6O |
| Molecular Weight | 452.51 g/mol |
| Exact Mass | 452.21 |
| IUPAC Name | N-[5-fluoro-4-[8-fluoro-4-(2-methylpropyl)-2,3-dihydro-1,4-benzoxazin-6-yl]pyrimidin-2-yl]-5,6,7,8-tetrahydro-1,6-naphthyridin-2-amine |
| SMILES | CC(C)CN1CCOc2c(F)cc(-c3nc(Nc4ccc5c(n4)CCNC5)ncc3F)cc21 |
| InChI | InChI=1S/C24H26F2N6O/c1-14(2)13-32-7-8-33-23-17(25)9-16(10-20(23)32)22-18(26)12-28-24(31-22)30-21-4-3-15-11-27-6-5-19(15)29-21/h3-4,9-10,12,14,27H,5-8,11,13H2,1-2H3,(H,28,29,30,31) |
| InChIKey | YPBVPXIBHMXSAS-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 75.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.51 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |