C27H30FN5O — CID 139409751
N-[5-cyclopropyl-4-(8-fluoro-4-propan-2-yl-2,3-dihydro-1,4-benzoxazin-6-yl)pyrimidin-2-yl]-1,2,3,4-tetrahydroisoquinolin-6-amine (PubChem CID 139409751) has the molecular formula C27H30FN5O and a molecular weight of 459.57 g/mol. Its IUPAC name is N-[5-cyclopropyl-4-(8-fluoro-4-propan-2-yl-2,3-dihydro-1,4-benzoxazin-6-yl)pyrimidin-2-yl]-1,2,3,4-tetrahydroisoquinolin-6-amine.
| Compound Name | N-[5-cyclopropyl-4-(8-fluoro-4-propan-2-yl-2,3-dihydro-1,4-benzoxazin-6-yl)pyrimidin-2-yl]-1,2,3,4-tetrahydroisoquinolin-6-amine |
|---|---|
| PubChem CID | 139409751 |
| Molecular Formula | C27H30FN5O |
| Molecular Weight | 459.57 g/mol |
| Exact Mass | 459.24 |
| IUPAC Name | N-[5-cyclopropyl-4-(8-fluoro-4-propan-2-yl-2,3-dihydro-1,4-benzoxazin-6-yl)pyrimidin-2-yl]-1,2,3,4-tetrahydroisoquinolin-6-amine |
| SMILES | CC(C)N1CCOc2c(F)cc(-c3nc(Nc4ccc5c(c4)CCNC5)ncc3C3CC3)cc21 |
| InChI | InChI=1S/C27H30FN5O/c1-16(2)33-9-10-34-26-23(28)12-20(13-24(26)33)25-22(17-3-4-17)15-30-27(32-25)31-21-6-5-19-14-29-8-7-18(19)11-21/h5-6,11-13,15-17,29H,3-4,7-10,14H2,1-2H3,(H,30,31,32) |
| InChIKey | KJFMMQGQOGIRCH-UHFFFAOYSA-N |
| XLogP | 5.16 |
| TPSA | 62.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.57 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |