C25H25F4N5O2 — CID 139409664
N-[4-(8-fluoro-4-propan-2-yl-2,3-dihydro-1,4-benzoxazin-6-yl)-5-(trifluoromethoxy)pyrimidin-2-yl]-1,2,3,4-tetrahydroisoquinolin-6-amine (PubChem CID 139409664) has the molecular formula C25H25F4N5O2 and a molecular weight of 503.50 g/mol. Its IUPAC name is N-[4-(8-fluoro-4-propan-2-yl-2,3-dihydro-1,4-benzoxazin-6-yl)-5-(trifluoromethoxy)pyrimidin-2-yl]-1,2,3,4-tetrahydroisoquinolin-6-amine.
| Compound Name | N-[4-(8-fluoro-4-propan-2-yl-2,3-dihydro-1,4-benzoxazin-6-yl)-5-(trifluoromethoxy)pyrimidin-2-yl]-1,2,3,4-tetrahydroisoquinolin-6-amine |
|---|---|
| PubChem CID | 139409664 |
| Molecular Formula | C25H25F4N5O2 |
| Molecular Weight | 503.50 g/mol |
| Exact Mass | 503.19 |
| IUPAC Name | N-[4-(8-fluoro-4-propan-2-yl-2,3-dihydro-1,4-benzoxazin-6-yl)-5-(trifluoromethoxy)pyrimidin-2-yl]-1,2,3,4-tetrahydroisoquinolin-6-amine |
| SMILES | CC(C)N1CCOc2c(F)cc(-c3nc(Nc4ccc5c(c4)CCNC5)ncc3OC(F)(F)F)cc21 |
| InChI | InChI=1S/C25H25F4N5O2/c1-14(2)34-7-8-35-23-19(26)10-17(11-20(23)34)22-21(36-25(27,28)29)13-31-24(33-22)32-18-4-3-16-12-30-6-5-15(16)9-18/h3-4,9-11,13-14,30H,5-8,12H2,1-2H3,(H,31,32,33) |
| InChIKey | IOHWUVDTMCTTJD-UHFFFAOYSA-N |
| XLogP | 5.18 |
| TPSA | 71.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.50 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |