C27H30F2N6O2 — CID 139410457
1-[6-[[5-fluoro-4-(8-fluoro-4-propan-2-yl-2,3-dihydro-1,4-benzoxazin-6-yl)pyrimidin-2-yl]amino]-1,2,3,4-tetrahydronaphthalen-2-yl]-3-methylurea (PubChem CID 139410457) has the molecular formula C27H30F2N6O2 and a molecular weight of 508.57 g/mol. Its IUPAC name is 1-[6-[[5-fluoro-4-(8-fluoro-4-propan-2-yl-2,3-dihydro-1,4-benzoxazin-6-yl)pyrimidin-2-yl]amino]-1,2,3,4-tetrahydronaphthalen-2-yl]-3-methylurea.
| Compound Name | 1-[6-[[5-fluoro-4-(8-fluoro-4-propan-2-yl-2,3-dihydro-1,4-benzoxazin-6-yl)pyrimidin-2-yl]amino]-1,2,3,4-tetrahydronaphthalen-2-yl]-3-methylurea |
|---|---|
| PubChem CID | 139410457 |
| Molecular Formula | C27H30F2N6O2 |
| Molecular Weight | 508.57 g/mol |
| Exact Mass | 508.24 |
| IUPAC Name | 1-[6-[[5-fluoro-4-(8-fluoro-4-propan-2-yl-2,3-dihydro-1,4-benzoxazin-6-yl)pyrimidin-2-yl]amino]-1,2,3,4-tetrahydronaphthalen-2-yl]-3-methylurea |
| SMILES | CNC(=O)NC1CCc2cc(Nc3ncc(F)c(-c4cc(F)c5c(c4)N(C(C)C)CCO5)n3)ccc2C1 |
| InChI | InChI=1S/C27H30F2N6O2/c1-15(2)35-8-9-37-25-21(28)12-18(13-23(25)35)24-22(29)14-31-26(34-24)32-19-6-4-17-11-20(33-27(36)30-3)7-5-16(17)10-19/h4,6,10,12-15,20H,5,7-9,11H2,1-3H3,(H2,30,33,36)(H,31,32,34) |
| InChIKey | XQSIYZSACRDVKH-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 91.41 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.57 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |