C24H25F2N5S — CID 166121036
N-[5-fluoro-4-(8-fluoro-4-propan-2-yl-2,3-dihydro-1,4-benzothiazin-6-yl)pyrimidin-2-yl]-1,2,3,4-tetrahydroisoquinolin-7-amine (PubChem CID 166121036) has the molecular formula C24H25F2N5S and a molecular weight of 453.56 g/mol. Its IUPAC name is N-[5-fluoro-4-(8-fluoro-4-propan-2-yl-2,3-dihydro-1,4-benzothiazin-6-yl)pyrimidin-2-yl]-1,2,3,4-tetrahydroisoquinolin-7-amine.
| Compound Name | N-[5-fluoro-4-(8-fluoro-4-propan-2-yl-2,3-dihydro-1,4-benzothiazin-6-yl)pyrimidin-2-yl]-1,2,3,4-tetrahydroisoquinolin-7-amine |
|---|---|
| PubChem CID | 166121036 |
| Molecular Formula | C24H25F2N5S |
| Molecular Weight | 453.56 g/mol |
| Exact Mass | 453.18 |
| IUPAC Name | N-[5-fluoro-4-(8-fluoro-4-propan-2-yl-2,3-dihydro-1,4-benzothiazin-6-yl)pyrimidin-2-yl]-1,2,3,4-tetrahydroisoquinolin-7-amine |
| SMILES | CC(C)N1CCSc2c(F)cc(-c3nc(Nc4ccc5c(c4)CNCC5)ncc3F)cc21 |
| InChI | InChI=1S/C24H25F2N5S/c1-14(2)31-7-8-32-23-19(25)10-16(11-21(23)31)22-20(26)13-28-24(30-22)29-18-4-3-15-5-6-27-12-17(15)9-18/h3-4,9-11,13-14,27H,5-8,12H2,1-2H3,(H,28,29,30) |
| InChIKey | QCYDZEMWOBJYMF-UHFFFAOYSA-N |
| XLogP | 5.13 |
| TPSA | 53.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.56 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |