C24H21F2N5O2S — CID 166120816
8-fluoro-6-[5-fluoro-2-(1,2,3,4-tetrahydroisoquinolin-6-ylamino)pyrimidin-4-yl]-4-propan-2-yl-1,4-benzothiazine-2,3-dione (PubChem CID 166120816) has the molecular formula C24H21F2N5O2S and a molecular weight of 481.53 g/mol. Its IUPAC name is 8-fluoro-6-[5-fluoro-2-(1,2,3,4-tetrahydroisoquinolin-6-ylamino)pyrimidin-4-yl]-4-propan-2-yl-1,4-benzothiazine-2,3-dione.
| Compound Name | 8-fluoro-6-[5-fluoro-2-(1,2,3,4-tetrahydroisoquinolin-6-ylamino)pyrimidin-4-yl]-4-propan-2-yl-1,4-benzothiazine-2,3-dione |
|---|---|
| PubChem CID | 166120816 |
| Molecular Formula | C24H21F2N5O2S |
| Molecular Weight | 481.53 g/mol |
| Exact Mass | 481.14 |
| IUPAC Name | 8-fluoro-6-[5-fluoro-2-(1,2,3,4-tetrahydroisoquinolin-6-ylamino)pyrimidin-4-yl]-4-propan-2-yl-1,4-benzothiazine-2,3-dione |
| SMILES | CC(C)n1c(=O)c(=O)sc2c(F)cc(-c3nc(Nc4ccc5c(c4)CCNC5)ncc3F)cc21 |
| InChI | InChI=1S/C24H21F2N5O2S/c1-12(2)31-19-9-15(8-17(25)21(19)34-23(33)22(31)32)20-18(26)11-28-24(30-20)29-16-4-3-14-10-27-6-5-13(14)7-16/h3-4,7-9,11-12,27H,5-6,10H2,1-2H3,(H,28,29,30) |
| InChIKey | IGPVAJJHBLBVCA-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 88.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.53 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|