C26H29FN4O — CID 146761817
8-fluoro-6-[5-methyl-2-(1,2,3,4-tetrahydroisoquinolin-6-ylmethyl)pyrimidin-4-yl]-4-propan-2-yl-2,3-dihydro-1,4-benzoxazine (PubChem CID 146761817) has the molecular formula C26H29FN4O and a molecular weight of 432.54 g/mol. Its IUPAC name is 8-fluoro-6-[5-methyl-2-(1,2,3,4-tetrahydroisoquinolin-6-ylmethyl)pyrimidin-4-yl]-4-propan-2-yl-2,3-dihydro-1,4-benzoxazine.
| Compound Name | 8-fluoro-6-[5-methyl-2-(1,2,3,4-tetrahydroisoquinolin-6-ylmethyl)pyrimidin-4-yl]-4-propan-2-yl-2,3-dihydro-1,4-benzoxazine |
|---|---|
| PubChem CID | 146761817 |
| Molecular Formula | C26H29FN4O |
| Molecular Weight | 432.54 g/mol |
| Exact Mass | 432.23 |
| IUPAC Name | 8-fluoro-6-[5-methyl-2-(1,2,3,4-tetrahydroisoquinolin-6-ylmethyl)pyrimidin-4-yl]-4-propan-2-yl-2,3-dihydro-1,4-benzoxazine |
| SMILES | Cc1cnc(Cc2ccc3c(c2)CCNC3)nc1-c1cc(F)c2c(c1)N(C(C)C)CCO2 |
| InChI | InChI=1S/C26H29FN4O/c1-16(2)31-8-9-32-26-22(27)12-21(13-23(26)31)25-17(3)14-29-24(30-25)11-18-4-5-20-15-28-7-6-19(20)10-18/h4-5,10,12-14,16,28H,6-9,11,15H2,1-3H3 |
| InChIKey | RPOSEDITRIVAOX-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 50.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.54 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |