C25H24F4N4O — CID 153174011
2,2,8-trifluoro-6-[5-fluoro-2-(1,2,3,4-tetrahydroisoquinolin-6-ylmethyl)pyrimidin-4-yl]-4-propan-2-yl-3H-1,4-benzoxazine (PubChem CID 153174011) has the molecular formula C25H24F4N4O and a molecular weight of 472.49 g/mol. Its IUPAC name is 2,2,8-trifluoro-6-[5-fluoro-2-(1,2,3,4-tetrahydroisoquinolin-6-ylmethyl)pyrimidin-4-yl]-4-propan-2-yl-3H-1,4-benzoxazine.
| Compound Name | 2,2,8-trifluoro-6-[5-fluoro-2-(1,2,3,4-tetrahydroisoquinolin-6-ylmethyl)pyrimidin-4-yl]-4-propan-2-yl-3H-1,4-benzoxazine |
|---|---|
| PubChem CID | 153174011 |
| Molecular Formula | C25H24F4N4O |
| Molecular Weight | 472.49 g/mol |
| Exact Mass | 472.19 |
| IUPAC Name | 2,2,8-trifluoro-6-[5-fluoro-2-(1,2,3,4-tetrahydroisoquinolin-6-ylmethyl)pyrimidin-4-yl]-4-propan-2-yl-3H-1,4-benzoxazine |
| SMILES | CC(C)N1CC(F)(F)Oc2c(F)cc(-c3nc(Cc4ccc5c(c4)CCNC5)ncc3F)cc21 |
| InChI | InChI=1S/C25H24F4N4O/c1-14(2)33-13-25(28,29)34-24-19(26)9-18(10-21(24)33)23-20(27)12-31-22(32-23)8-15-3-4-17-11-30-6-5-16(17)7-15/h3-4,7,9-10,12,14,30H,5-6,8,11,13H2,1-2H3 |
| InChIKey | WEUKSRSLXUDLLW-UHFFFAOYSA-N |
| XLogP | 4.86 |
| TPSA | 50.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.49 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |