C17H18N4O — CID 139391804
[3-[[5-(4-aminophenyl)-1H-pyrazol-3-yl]amino]-4-methylphenyl]methanol (PubChem CID 139391804) has the molecular formula C17H18N4O and a molecular weight of 294.36 g/mol. Its IUPAC name is [3-[[5-(4-aminophenyl)-1H-pyrazol-3-yl]amino]-4-methylphenyl]methanol.
| Compound Name | [3-[[5-(4-aminophenyl)-1H-pyrazol-3-yl]amino]-4-methylphenyl]methanol |
|---|---|
| PubChem CID | 139391804 |
| Molecular Formula | C17H18N4O |
| Molecular Weight | 294.36 g/mol |
| Exact Mass | 294.15 |
| IUPAC Name | [3-[[5-(4-aminophenyl)-1H-pyrazol-3-yl]amino]-4-methylphenyl]methanol |
| SMILES | Cc1ccc(CO)cc1Nc1cc(-c2ccc(N)cc2)[nH]n1 |
| InChI | InChI=1S/C17H18N4O/c1-11-2-3-12(10-22)8-15(11)19-17-9-16(20-21-17)13-4-6-14(18)7-5-13/h2-9,22H,10,18H2,1H3,(H2,19,20,21) |
| InChIKey | JDTZZBQSIZUVHU-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 86.96 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.36 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|