C27H30N2O7S — CID 139393230
(E)-N-[(4R,4aS,7R,7aR,12bS)-3-cyclopropylsulfonyl-4a-hydroxy-9-methoxy-1,2,4,5,6,7,7a,13-octahydro-4,12-methanobenzofuro[3,2-e]isoquinolin-7-yl]-3-(furan-3-yl)prop-2-enamide (PubChem CID 139393230) has the molecular formula C27H30N2O7S and a molecular weight of 526.61 g/mol. Its IUPAC name is (E)-N-[(4R,4aS,7R,7aR,12bS)-3-cyclopropylsulfonyl-4a-hydroxy-9-methoxy-1,2,4,5,6,7,7a,13-octahydro-4,12-methanobenzofuro[3,2-e]isoquinolin-7-yl]-3-(furan-3-yl)prop-2-enamide.
| Compound Name | (E)-N-[(4R,4aS,7R,7aR,12bS)-3-cyclopropylsulfonyl-4a-hydroxy-9-methoxy-1,2,4,5,6,7,7a,13-octahydro-4,12-methanobenzofuro[3,2-e]isoquinolin-7-yl]-3-(furan-3-yl)prop-2-enamide |
|---|---|
| PubChem CID | 139393230 |
| Molecular Formula | C27H30N2O7S |
| Molecular Weight | 526.61 g/mol |
| Exact Mass | 526.18 |
| IUPAC Name | (E)-N-[(4R,4aS,7R,7aR,12bS)-3-cyclopropylsulfonyl-4a-hydroxy-9-methoxy-1,2,4,5,6,7,7a,13-octahydro-4,12-methanobenzofuro[3,2-e]isoquinolin-7-yl]-3-(furan-3-yl)prop-2-enamide |
| SMILES | COc1ccc2c3c1O[C@H]1[C@H](NC(=O)/C=C/c4ccoc4)CC[C@@]4(O)[C@@H](C2)N(S(=O)(=O)C2CC2)CC[C@]314 |
| InChI | InChI=1S/C27H30N2O7S/c1-34-20-6-3-17-14-21-27(31)10-8-19(28-22(30)7-2-16-9-13-35-15-16)25-26(27,23(17)24(20)36-25)11-12-29(21)37(32,33)18-4-5-18/h2-3,6-7,9,13,15,18-19,21,25,31H,4-5,8,10-12,14H2,1H3,(H,28,30)/b7-2+/t19-,21-,25+,26+,27-/m1/s1 |
| InChIKey | APQYWCSPHLEUNT-OLQPISSUSA-N |
| XLogP | 2.13 |
| TPSA | 118.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.61 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|