C28H31NO5S — CID 54262131
S-[(4R,12bS)-3-(cyclopropylmethyl)-4a-hydroxy-9-methoxy-1,2,4,5,6,7,7a,13-octahydro-4,12-methanobenzofuro[3,2-e]isoquinolin-7-yl] 3-(furan-3-yl)prop-2-enethioate (PubChem CID 54262131) has the molecular formula C28H31NO5S and a molecular weight of 493.63 g/mol. Its IUPAC name is S-[(4R,12bS)-3-(cyclopropylmethyl)-4a-hydroxy-9-methoxy-1,2,4,5,6,7,7a,13-octahydro-4,12-methanobenzofuro[3,2-e]isoquinolin-7-yl] 3-(furan-3-yl)prop-2-enethioate.
| Compound Name | S-[(4R,12bS)-3-(cyclopropylmethyl)-4a-hydroxy-9-methoxy-1,2,4,5,6,7,7a,13-octahydro-4,12-methanobenzofuro[3,2-e]isoquinolin-7-yl] 3-(furan-3-yl)prop-2-enethioate |
|---|---|
| PubChem CID | 54262131 |
| Molecular Formula | C28H31NO5S |
| Molecular Weight | 493.63 g/mol |
| Exact Mass | 493.19 |
| IUPAC Name | S-[(4R,12bS)-3-(cyclopropylmethyl)-4a-hydroxy-9-methoxy-1,2,4,5,6,7,7a,13-octahydro-4,12-methanobenzofuro[3,2-e]isoquinolin-7-yl] 3-(furan-3-yl)prop-2-enethioate |
| SMILES | COc1ccc2c3c1OC1C(SC(=O)C=Cc4ccoc4)CCC4(O)[C@@H](C2)N(CC2CC2)CC[C@]314 |
| InChI | InChI=1S/C28H31NO5S/c1-32-20-6-5-19-14-22-28(31)10-8-21(35-23(30)7-4-18-9-13-33-16-18)26-27(28,24(19)25(20)34-26)11-12-29(22)15-17-2-3-17/h4-7,9,13,16-17,21-22,26,31H,2-3,8,10-12,14-15H2,1H3/t21?,22-,26?,27+,28?/m1/s1 |
| InChIKey | REGBJADJOAIFAU-QIPFUEDFSA-N |
| XLogP | 4.19 |
| TPSA | 72.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.63 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|