C28H29F3N4O3 — CID 139393907
N-[3-[(4aR)-5-[hydroxy(methylamino)methyl]-1,2,4,4a,5,6-hexahydro-[1,4]oxazino[4,3-a]quinolin-9-yl]-4-methylphenyl]-2-(trifluoromethyl)pyridine-4-carboxamide (PubChem CID 139393907) has the molecular formula C28H29F3N4O3 and a molecular weight of 526.56 g/mol. Its IUPAC name is N-[3-[(4aR)-5-[hydroxy(methylamino)methyl]-1,2,4,4a,5,6-hexahydro-[1,4]oxazino[4,3-a]quinolin-9-yl]-4-methylphenyl]-2-(trifluoromethyl)pyridine-4-carboxamide.
| Compound Name | N-[3-[(4aR)-5-[hydroxy(methylamino)methyl]-1,2,4,4a,5,6-hexahydro-[1,4]oxazino[4,3-a]quinolin-9-yl]-4-methylphenyl]-2-(trifluoromethyl)pyridine-4-carboxamide |
|---|---|
| PubChem CID | 139393907 |
| Molecular Formula | C28H29F3N4O3 |
| Molecular Weight | 526.56 g/mol |
| Exact Mass | 526.22 |
| IUPAC Name | N-[3-[(4aR)-5-[hydroxy(methylamino)methyl]-1,2,4,4a,5,6-hexahydro-[1,4]oxazino[4,3-a]quinolin-9-yl]-4-methylphenyl]-2-(trifluoromethyl)pyridine-4-carboxamide |
| SMILES | CNC(O)C1Cc2ccc(-c3cc(NC(=O)c4ccnc(C(F)(F)F)c4)ccc3C)cc2N2CCOC[C@@H]12 |
| InChI | InChI=1S/C28H29F3N4O3/c1-16-3-6-20(34-26(36)19-7-8-33-25(13-19)28(29,30)31)14-21(16)17-4-5-18-11-22(27(37)32-2)24-15-38-10-9-35(24)23(18)12-17/h3-8,12-14,22,24,27,32,37H,9-11,15H2,1-2H3,(H,34,36)/t22?,24-,27?/m0/s1 |
| InChIKey | UXRJCSYKRNCQGM-CRIAOJQNSA-N |
| XLogP | 4.24 |
| TPSA | 86.72 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.56 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|