C29H32F3N3O3 — CID 145332978
ethane;N-[3-(6-hydroxy-4a-methyl-2,4,5,6-tetrahydro-1H-[1,4]oxazino[4,3-a]quinolin-9-yl)-4-methylphenyl]-2-(trifluoromethyl)pyridine-4-carboxamide (PubChem CID 145332978) has the molecular formula C29H32F3N3O3 and a molecular weight of 527.59 g/mol. Its IUPAC name is ethane;N-[3-(6-hydroxy-4a-methyl-2,4,5,6-tetrahydro-1H-[1,4]oxazino[4,3-a]quinolin-9-yl)-4-methylphenyl]-2-(trifluoromethyl)pyridine-4-carboxamide.
| Compound Name | ethane;N-[3-(6-hydroxy-4a-methyl-2,4,5,6-tetrahydro-1H-[1,4]oxazino[4,3-a]quinolin-9-yl)-4-methylphenyl]-2-(trifluoromethyl)pyridine-4-carboxamide |
|---|---|
| PubChem CID | 145332978 |
| Molecular Formula | C29H32F3N3O3 |
| Molecular Weight | 527.59 g/mol |
| Exact Mass | 527.24 |
| IUPAC Name | ethane;N-[3-(6-hydroxy-4a-methyl-2,4,5,6-tetrahydro-1H-[1,4]oxazino[4,3-a]quinolin-9-yl)-4-methylphenyl]-2-(trifluoromethyl)pyridine-4-carboxamide |
| SMILES | CC.Cc1ccc(NC(=O)c2ccnc(C(F)(F)F)c2)cc1-c1ccc2c(c1)N1CCOCC1(C)CC2O |
| InChI | InChI=1S/C27H26F3N3O3.C2H6/c1-16-3-5-19(32-25(35)18-7-8-31-24(12-18)27(28,29)30)13-21(16)17-4-6-20-22(11-17)33-9-10-36-15-26(33,2)14-23(20)34;1-2/h3-8,11-13,23,34H,9-10,14-15H2,1-2H3,(H,32,35);1-2H3 |
| InChIKey | MQKDFFJIIMAUDI-UHFFFAOYSA-N |
| XLogP | 6.39 |
| TPSA | 74.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.59 |
| LogP ≤ 5 | 6.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |