C15H20O2 — CID 139395182
5-[(E)-3-hydroxyprop-1-enyl]-2-(4-methylpent-3-enyl)phenol (PubChem CID 139395182) has the molecular formula C15H20O2 and a molecular weight of 232.32 g/mol. Its IUPAC name is 5-[(E)-3-hydroxyprop-1-enyl]-2-(4-methylpent-3-enyl)phenol.
| Compound Name | 5-[(E)-3-hydroxyprop-1-enyl]-2-(4-methylpent-3-enyl)phenol |
|---|---|
| PubChem CID | 139395182 |
| Molecular Formula | C15H20O2 |
| Molecular Weight | 232.32 g/mol |
| Exact Mass | 232.15 |
| IUPAC Name | 5-[(E)-3-hydroxyprop-1-enyl]-2-(4-methylpent-3-enyl)phenol |
| SMILES | CC(C)=CCCc1ccc(/C=C/CO)cc1O |
| InChI | InChI=1S/C15H20O2/c1-12(2)5-3-7-14-9-8-13(6-4-10-16)11-15(14)17/h4-6,8-9,11,16-17H,3,7,10H2,1-2H3/b6-4+ |
| InChIKey | UGLJOBBZQVIDSL-GQCTYLIASA-N |
| XLogP | 3.30 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.32 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|