C22H30N4O — CID 139397692
(3R)-N-[5-(3-butylphenyl)-1-ethylpyrazol-3-yl]-6-methylidenepiperidine-3-carboxamide (PubChem CID 139397692) has the molecular formula C22H30N4O and a molecular weight of 366.51 g/mol. Its IUPAC name is (3R)-N-[5-(3-butylphenyl)-1-ethylpyrazol-3-yl]-6-methylidenepiperidine-3-carboxamide.
| Compound Name | (3R)-N-[5-(3-butylphenyl)-1-ethylpyrazol-3-yl]-6-methylidenepiperidine-3-carboxamide |
|---|---|
| PubChem CID | 139397692 |
| Molecular Formula | C22H30N4O |
| Molecular Weight | 366.51 g/mol |
| Exact Mass | 366.24 |
| IUPAC Name | (3R)-N-[5-(3-butylphenyl)-1-ethylpyrazol-3-yl]-6-methylidenepiperidine-3-carboxamide |
| SMILES | C=C1CC[C@@H](C(=O)Nc2cc(-c3cccc(CCCC)c3)n(CC)n2)CN1 |
| InChI | InChI=1S/C22H30N4O/c1-4-6-8-17-9-7-10-18(13-17)20-14-21(25-26(20)5-2)24-22(27)19-12-11-16(3)23-15-19/h7,9-10,13-14,19,23H,3-6,8,11-12,15H2,1-2H3,(H,24,25,27)/t19-/m1/s1 |
| InChIKey | VKGLIDTWLSCWRU-LJQANCHMSA-N |
| XLogP | 4.36 |
| TPSA | 58.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.51 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |