C25H28N4O — CID 158031706
(3R)-N-[5-(3-butylphenyl)-1-phenylpyrazol-3-yl]-5-methylidenepyrrolidine-3-carboxamide (PubChem CID 158031706) has the molecular formula C25H28N4O and a molecular weight of 400.53 g/mol. Its IUPAC name is (3R)-N-[5-(3-butylphenyl)-1-phenylpyrazol-3-yl]-5-methylidenepyrrolidine-3-carboxamide.
| Compound Name | (3R)-N-[5-(3-butylphenyl)-1-phenylpyrazol-3-yl]-5-methylidenepyrrolidine-3-carboxamide |
|---|---|
| PubChem CID | 158031706 |
| Molecular Formula | C25H28N4O |
| Molecular Weight | 400.53 g/mol |
| Exact Mass | 400.23 |
| IUPAC Name | (3R)-N-[5-(3-butylphenyl)-1-phenylpyrazol-3-yl]-5-methylidenepyrrolidine-3-carboxamide |
| SMILES | C=C1C[C@@H](C(=O)Nc2cc(-c3cccc(CCCC)c3)n(-c3ccccc3)n2)CN1 |
| InChI | InChI=1S/C25H28N4O/c1-3-4-9-19-10-8-11-20(15-19)23-16-24(27-25(30)21-14-18(2)26-17-21)28-29(23)22-12-6-5-7-13-22/h5-8,10-13,15-16,21,26H,2-4,9,14,17H2,1H3,(H,27,28,30)/t21-/m1/s1 |
| InChIKey | HEVOIILXXIIVGT-OAQYLSRUSA-N |
| XLogP | 4.94 |
| TPSA | 58.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.53 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |