C28H34N4O3 — CID 139398297
4-[4-(2-methoxyethoxy)piperidin-1-yl]-N-[4-[4-(methylamino)anilino]phenyl]benzamide (PubChem CID 139398297) has the molecular formula C28H34N4O3 and a molecular weight of 474.61 g/mol. Its IUPAC name is 4-[4-(2-methoxyethoxy)piperidin-1-yl]-N-[4-[4-(methylamino)anilino]phenyl]benzamide.
| Compound Name | 4-[4-(2-methoxyethoxy)piperidin-1-yl]-N-[4-[4-(methylamino)anilino]phenyl]benzamide |
|---|---|
| PubChem CID | 139398297 |
| Molecular Formula | C28H34N4O3 |
| Molecular Weight | 474.61 g/mol |
| Exact Mass | 474.26 |
| IUPAC Name | 4-[4-(2-methoxyethoxy)piperidin-1-yl]-N-[4-[4-(methylamino)anilino]phenyl]benzamide |
| SMILES | CNc1ccc(Nc2ccc(NC(=O)c3ccc(N4CCC(OCCOC)CC4)cc3)cc2)cc1 |
| InChI | InChI=1S/C28H34N4O3/c1-29-22-5-7-23(8-6-22)30-24-9-11-25(12-10-24)31-28(33)21-3-13-26(14-4-21)32-17-15-27(16-18-32)35-20-19-34-2/h3-14,27,29-30H,15-20H2,1-2H3,(H,31,33) |
| InChIKey | VGXSYXDQXBHQMY-UHFFFAOYSA-N |
| XLogP | 5.36 |
| TPSA | 74.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.61 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_NH_alk_B(3)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|