C35H39N3O4 — CID 159611973
1-[4-[4-(2-methoxyethoxy)piperidin-1-yl]phenyl]-2-[4-[4-[2-(1-methylpyrrol-2-yl)-2-oxoethyl]anilino]phenyl]ethanone (PubChem CID 159611973) has the molecular formula C35H39N3O4 and a molecular weight of 565.71 g/mol. Its IUPAC name is 1-[4-[4-(2-methoxyethoxy)piperidin-1-yl]phenyl]-2-[4-[4-[2-(1-methylpyrrol-2-yl)-2-oxoethyl]anilino]phenyl]ethanone.
| Compound Name | 1-[4-[4-(2-methoxyethoxy)piperidin-1-yl]phenyl]-2-[4-[4-[2-(1-methylpyrrol-2-yl)-2-oxoethyl]anilino]phenyl]ethanone |
|---|---|
| PubChem CID | 159611973 |
| Molecular Formula | C35H39N3O4 |
| Molecular Weight | 565.71 g/mol |
| Exact Mass | 565.29 |
| IUPAC Name | 1-[4-[4-(2-methoxyethoxy)piperidin-1-yl]phenyl]-2-[4-[4-[2-(1-methylpyrrol-2-yl)-2-oxoethyl]anilino]phenyl]ethanone |
| SMILES | COCCOC1CCN(c2ccc(C(=O)Cc3ccc(Nc4ccc(CC(=O)c5cccn5C)cc4)cc3)cc2)CC1 |
| InChI | InChI=1S/C35H39N3O4/c1-37-19-3-4-33(37)35(40)25-27-7-13-30(14-8-27)36-29-11-5-26(6-12-29)24-34(39)28-9-15-31(16-10-28)38-20-17-32(18-21-38)42-23-22-41-2/h3-16,19,32,36H,17-18,20-25H2,1-2H3 |
| InChIKey | MMURPNDAWZPQER-UHFFFAOYSA-N |
| XLogP | 6.25 |
| TPSA | 72.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 565.71 |
| LogP ≤ 5 | 6.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|