C24H28F2N6O2 — CID 139398486
1-[5-[6-(difluoromethyl)-5-(1-methylpyrazol-4-yl)-2,3-dihydroindole-1-carboximidoyl]-4-(oxetan-3-ylamino)-3,6-dihydro-2H-pyridin-1-yl]ethanone (PubChem CID 139398486) has the molecular formula C24H28F2N6O2 and a molecular weight of 470.52 g/mol. Its IUPAC name is 1-[5-[6-(difluoromethyl)-5-(1-methylpyrazol-4-yl)-2,3-dihydroindole-1-carboximidoyl]-4-(oxetan-3-ylamino)-3,6-dihydro-2H-pyridin-1-yl]ethanone.
| Compound Name | 1-[5-[6-(difluoromethyl)-5-(1-methylpyrazol-4-yl)-2,3-dihydroindole-1-carboximidoyl]-4-(oxetan-3-ylamino)-3,6-dihydro-2H-pyridin-1-yl]ethanone |
|---|---|
| PubChem CID | 139398486 |
| Molecular Formula | C24H28F2N6O2 |
| Molecular Weight | 470.52 g/mol |
| Exact Mass | 470.22 |
| IUPAC Name | 1-[5-[6-(difluoromethyl)-5-(1-methylpyrazol-4-yl)-2,3-dihydroindole-1-carboximidoyl]-4-(oxetan-3-ylamino)-3,6-dihydro-2H-pyridin-1-yl]ethanone |
| SMILES | [H]/N=C(\C1=C(NC2COC2)CCN(C(C)=O)C1)N1CCc2cc(-c3cnn(C)c3)c(C(F)F)cc21 |
| InChI | InChI=1S/C24H28F2N6O2/c1-14(33)31-5-4-21(29-17-12-34-13-17)20(11-31)24(27)32-6-3-15-7-18(16-9-28-30(2)10-16)19(23(25)26)8-22(15)32/h7-10,17,23,27,29H,3-6,11-13H2,1-2H3/b27-24+ |
| InChIKey | UJGKUUDGLPSUTP-SOYKGTTHSA-N |
| XLogP | 2.86 |
| TPSA | 86.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.52 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|