C31H38N6O2 — CID 145090308
benzene;1-[5-[6-(1-methylpyrazol-4-yl)-3,4-dihydro-2H-quinoline-1-carboximidoyl]-4-(oxolan-3-ylamino)-3,6-dihydro-2H-pyridin-1-yl]ethanone (PubChem CID 145090308) has the molecular formula C31H38N6O2 and a molecular weight of 526.69 g/mol. Its IUPAC name is benzene;1-[5-[6-(1-methylpyrazol-4-yl)-3,4-dihydro-2H-quinoline-1-carboximidoyl]-4-(oxolan-3-ylamino)-3,6-dihydro-2H-pyridin-1-yl]ethanone.
| Compound Name | benzene;1-[5-[6-(1-methylpyrazol-4-yl)-3,4-dihydro-2H-quinoline-1-carboximidoyl]-4-(oxolan-3-ylamino)-3,6-dihydro-2H-pyridin-1-yl]ethanone |
|---|---|
| PubChem CID | 145090308 |
| Molecular Formula | C31H38N6O2 |
| Molecular Weight | 526.69 g/mol |
| Exact Mass | 526.31 |
| IUPAC Name | benzene;1-[5-[6-(1-methylpyrazol-4-yl)-3,4-dihydro-2H-quinoline-1-carboximidoyl]-4-(oxolan-3-ylamino)-3,6-dihydro-2H-pyridin-1-yl]ethanone |
| SMILES | [H]/N=C(\C1=C(NC2CCOC2)CCN(C(C)=O)C1)N1CCCc2cc(-c3cnn(C)c3)ccc21.c1ccccc1 |
| InChI | InChI=1S/C25H32N6O2.C6H6/c1-17(32)30-10-7-23(28-21-8-11-33-16-21)22(15-30)25(26)31-9-3-4-19-12-18(5-6-24(19)31)20-13-27-29(2)14-20;1-2-4-6-5-3-1/h5-6,12-14,21,26,28H,3-4,7-11,15-16H2,1-2H3;1-6H/b26-25+; |
| InChIKey | VQBSUUZZCWBVAH-BTKVJIOYSA-N |
| XLogP | 4.39 |
| TPSA | 86.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.69 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|