C16H22N4 — CID 139399063
4-amino-N'-cyclopropyl-N-(3-methylphenyl)-1,2,3,6-tetrahydropyridine-5-carboximidamide (PubChem CID 139399063) has the molecular formula C16H22N4 and a molecular weight of 270.38 g/mol. Its IUPAC name is 4-amino-N'-cyclopropyl-N-(3-methylphenyl)-1,2,3,6-tetrahydropyridine-5-carboximidamide.
| Compound Name | 4-amino-N'-cyclopropyl-N-(3-methylphenyl)-1,2,3,6-tetrahydropyridine-5-carboximidamide |
|---|---|
| PubChem CID | 139399063 |
| Molecular Formula | C16H22N4 |
| Molecular Weight | 270.38 g/mol |
| Exact Mass | 270.18 |
| IUPAC Name | 4-amino-N'-cyclopropyl-N-(3-methylphenyl)-1,2,3,6-tetrahydropyridine-5-carboximidamide |
| SMILES | Cc1cccc(N/C(=N\C2CC2)C2=C(N)CCNC2)c1 |
| InChI | InChI=1S/C16H22N4/c1-11-3-2-4-13(9-11)20-16(19-12-5-6-12)14-10-18-8-7-15(14)17/h2-4,9,12,18H,5-8,10,17H2,1H3,(H,19,20) |
| InChIKey | OJXITOQMSBOXEK-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 62.44 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.38 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|