C23H25NO3S — CID 139399509
(1S)-1-[2-(1-benzothiophen-2-yl)ethyl]-7-ethoxy-6-methoxy-3,4-dihydro-1H-isoquinoline-2-carbaldehyde (PubChem CID 139399509) has the molecular formula C23H25NO3S and a molecular weight of 395.52 g/mol. Its IUPAC name is (1S)-1-[2-(1-benzothiophen-2-yl)ethyl]-7-ethoxy-6-methoxy-3,4-dihydro-1H-isoquinoline-2-carbaldehyde.
| Compound Name | (1S)-1-[2-(1-benzothiophen-2-yl)ethyl]-7-ethoxy-6-methoxy-3,4-dihydro-1H-isoquinoline-2-carbaldehyde |
|---|---|
| PubChem CID | 139399509 |
| Molecular Formula | C23H25NO3S |
| Molecular Weight | 395.52 g/mol |
| Exact Mass | 395.16 |
| IUPAC Name | (1S)-1-[2-(1-benzothiophen-2-yl)ethyl]-7-ethoxy-6-methoxy-3,4-dihydro-1H-isoquinoline-2-carbaldehyde |
| SMILES | CCOc1cc2c(cc1OC)CCN(C=O)[C@H]2CCc1cc2ccccc2s1 |
| InChI | InChI=1S/C23H25NO3S/c1-3-27-22-14-19-16(13-21(22)26-2)10-11-24(15-25)20(19)9-8-18-12-17-6-4-5-7-23(17)28-18/h4-7,12-15,20H,3,8-11H2,1-2H3/t20-/m0/s1 |
| InChIKey | LJOFUMFDFRYFJL-FQEVSTJZSA-N |
| XLogP | 5.00 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.52 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|