C22H27N3O3 — CID 139399585
(1S)-1-[3-(2-aminophenyl)-3-iminopropyl]-7-ethoxy-6-methoxy-3,4-dihydro-1H-isoquinoline-2-carbaldehyde (PubChem CID 139399585) has the molecular formula C22H27N3O3 and a molecular weight of 381.48 g/mol. Its IUPAC name is (1S)-1-[3-(2-aminophenyl)-3-iminopropyl]-7-ethoxy-6-methoxy-3,4-dihydro-1H-isoquinoline-2-carbaldehyde.
| Compound Name | (1S)-1-[3-(2-aminophenyl)-3-iminopropyl]-7-ethoxy-6-methoxy-3,4-dihydro-1H-isoquinoline-2-carbaldehyde |
|---|---|
| PubChem CID | 139399585 |
| Molecular Formula | C22H27N3O3 |
| Molecular Weight | 381.48 g/mol |
| Exact Mass | 381.21 |
| IUPAC Name | (1S)-1-[3-(2-aminophenyl)-3-iminopropyl]-7-ethoxy-6-methoxy-3,4-dihydro-1H-isoquinoline-2-carbaldehyde |
| SMILES | [H]/N=C(\CC[C@H]1c2cc(OCC)c(OC)cc2CCN1C=O)c1ccccc1N |
| InChI | InChI=1S/C22H27N3O3/c1-3-28-22-13-17-15(12-21(22)27-2)10-11-25(14-26)20(17)9-8-19(24)16-6-4-5-7-18(16)23/h4-7,12-14,20,24H,3,8-11,23H2,1-2H3/b24-19+/t20-/m0/s1 |
| InChIKey | CGIHDJYDLASASC-UNJZAIIMSA-N |
| XLogP | 3.58 |
| TPSA | 88.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.48 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|