C24H27N3O6S — CID 139401371
4-[4-[5-[[2-(2-hydroxyethoxy)ethylamino]methyl]thiophen-2-yl]buta-1,3-diynyl]-N-[(2S,3S)-3-hydroxy-1-(hydroxyamino)-1-oxobutan-2-yl]benzamide (PubChem CID 139401371) has the molecular formula C24H27N3O6S and a molecular weight of 485.56 g/mol. Its IUPAC name is 4-[4-[5-[[2-(2-hydroxyethoxy)ethylamino]methyl]thiophen-2-yl]buta-1,3-diynyl]-N-[(2S,3S)-3-hydroxy-1-(hydroxyamino)-1-oxobutan-2-yl]benzamide.
| Compound Name | 4-[4-[5-[[2-(2-hydroxyethoxy)ethylamino]methyl]thiophen-2-yl]buta-1,3-diynyl]-N-[(2S,3S)-3-hydroxy-1-(hydroxyamino)-1-oxobutan-2-yl]benzamide |
|---|---|
| PubChem CID | 139401371 |
| Molecular Formula | C24H27N3O6S |
| Molecular Weight | 485.56 g/mol |
| Exact Mass | 485.16 |
| IUPAC Name | 4-[4-[5-[[2-(2-hydroxyethoxy)ethylamino]methyl]thiophen-2-yl]buta-1,3-diynyl]-N-[(2S,3S)-3-hydroxy-1-(hydroxyamino)-1-oxobutan-2-yl]benzamide |
| SMILES | C[C@H](O)[C@H](NC(=O)c1ccc(C#CC#Cc2ccc(CNCCOCCO)s2)cc1)C(=O)NO |
| InChI | InChI=1S/C24H27N3O6S/c1-17(29)22(24(31)27-32)26-23(30)19-8-6-18(7-9-19)4-2-3-5-20-10-11-21(34-20)16-25-12-14-33-15-13-28/h6-11,17,22,25,28-29,32H,12-16H2,1H3,(H,26,30)(H,27,31)/t17-,22-/m0/s1 |
| InChIKey | YWFXXFKLNHVUGL-JTSKRJEESA-N |
| XLogP | 0.23 |
| TPSA | 140.15 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.56 |
| LogP ≤ 5 | 0.23 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|