C13H18N4O2 — CID 139402160
6-(pyridin-2-ylcarbamoylamino)hexyl cyanate (PubChem CID 139402160) has the molecular formula C13H18N4O2 and a molecular weight of 262.31 g/mol. Its IUPAC name is 6-(pyridin-2-ylcarbamoylamino)hexyl cyanate.
| Compound Name | 6-(pyridin-2-ylcarbamoylamino)hexyl cyanate |
|---|---|
| PubChem CID | 139402160 |
| Molecular Formula | C13H18N4O2 |
| Molecular Weight | 262.31 g/mol |
| Exact Mass | 262.14 |
| IUPAC Name | 6-(pyridin-2-ylcarbamoylamino)hexyl cyanate |
| SMILES | N#COCCCCCCNC(=O)Nc1ccccn1 |
| InChI | InChI=1S/C13H18N4O2/c14-11-19-10-6-2-1-4-9-16-13(18)17-12-7-3-5-8-15-12/h3,5,7-8H,1-2,4,6,9-10H2,(H2,15,16,17,18) |
| InChIKey | YVTQNTBQHHCDPE-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 87.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.31 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'} |
|---|