C15H27N3O4Si- — CID 145258364
CID 145258364 (PubChem CID 145258364) has the molecular formula C15H27N3O4Si- and a molecular weight of 341.48 g/mol.
| Compound Name | CID 145258364 |
|---|---|
| PubChem CID | 145258364 |
| Molecular Formula | C15H27N3O4Si- |
| Molecular Weight | 341.48 g/mol |
| Exact Mass | 341.18 |
| IUPAC Name | — |
| SMILES | CCO[Si-](CCCNC(=O)Nc1ccccn1)(OCC)OCC |
| InChI | InChI=1S/C15H27N3O4Si/c1-4-20-23(21-5-2,22-6-3)13-9-12-17-15(19)18-14-10-7-8-11-16-14/h7-8,10-11H,4-6,9,12-13H2,1-3H3,(H2,16,17,18,19)/q-1 |
| InChIKey | SJHQVNWSBMTASO-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 81.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.48 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|