C18H22N4 — CID 139402711
7-phenyl-4-piperazin-1-yl-5,6,7,8-tetrahydroquinazoline (PubChem CID 139402711) has the molecular formula C18H22N4 and a molecular weight of 294.40 g/mol. Its IUPAC name is 7-phenyl-4-piperazin-1-yl-5,6,7,8-tetrahydroquinazoline.
| Compound Name | 7-phenyl-4-piperazin-1-yl-5,6,7,8-tetrahydroquinazoline |
|---|---|
| PubChem CID | 139402711 |
| Molecular Formula | C18H22N4 |
| Molecular Weight | 294.40 g/mol |
| Exact Mass | 294.18 |
| IUPAC Name | 7-phenyl-4-piperazin-1-yl-5,6,7,8-tetrahydroquinazoline |
| SMILES | c1ccc(C2CCc3c(ncnc3N3CCNCC3)C2)cc1 |
| InChI | InChI=1S/C18H22N4/c1-2-4-14(5-3-1)15-6-7-16-17(12-15)20-13-21-18(16)22-10-8-19-9-11-22/h1-5,13,15,19H,6-12H2 |
| InChIKey | VYMNVUVCUGSTPQ-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 41.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.40 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |