C10H15N5 — CID 87437222
4-piperazin-1-yl-6,7-dihydro-5H-pyrrolo[2,3-d]pyrimidine (PubChem CID 87437222) has the molecular formula C10H15N5 and a molecular weight of 205.26 g/mol. Its IUPAC name is 4-piperazin-1-yl-6,7-dihydro-5H-pyrrolo[2,3-d]pyrimidine.
| Compound Name | 4-piperazin-1-yl-6,7-dihydro-5H-pyrrolo[2,3-d]pyrimidine |
|---|---|
| PubChem CID | 87437222 |
| Molecular Formula | C10H15N5 |
| Molecular Weight | 205.26 g/mol |
| Exact Mass | 205.13 |
| IUPAC Name | 4-piperazin-1-yl-6,7-dihydro-5H-pyrrolo[2,3-d]pyrimidine |
| SMILES | c1nc2c(c(N3CCNCC3)n1)CCN2 |
| InChI | InChI=1S/C10H15N5/c1-2-12-9-8(1)10(14-7-13-9)15-5-3-11-4-6-15/h7,11H,1-6H2,(H,12,13,14) |
| InChIKey | FTTVKZFSWPXEAE-UHFFFAOYSA-N |
| XLogP | -0.15 |
| TPSA | 53.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.26 |
| LogP ≤ 5 | -0.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |