C8H10N6S — CID 83849820
7-piperazin-1-ylthiadiazolo[5,4-d]pyrimidine (PubChem CID 83849820) has the molecular formula C8H10N6S and a molecular weight of 222.28 g/mol. Its IUPAC name is 7-piperazin-1-ylthiadiazolo[5,4-d]pyrimidine.
| Compound Name | 7-piperazin-1-ylthiadiazolo[5,4-d]pyrimidine |
|---|---|
| PubChem CID | 83849820 |
| Molecular Formula | C8H10N6S |
| Molecular Weight | 222.28 g/mol |
| Exact Mass | 222.07 |
| IUPAC Name | 7-piperazin-1-ylthiadiazolo[5,4-d]pyrimidine |
| SMILES | c1nc(N2CCNCC2)c2nnsc2n1 |
| InChI | InChI=1S/C8H10N6S/c1-3-14(4-2-9-1)7-6-8(11-5-10-7)15-13-12-6/h5,9H,1-4H2 |
| InChIKey | GRDQBSRADGYMSR-UHFFFAOYSA-N |
| XLogP | -0.11 |
| TPSA | 66.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.28 |
| LogP ≤ 5 | -0.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |