C10H14N4S — CID 86686511
4-piperazin-1-yl-6,7-dihydrothieno[3,2-d]pyrimidine (PubChem CID 86686511) has the molecular formula C10H14N4S and a molecular weight of 222.32 g/mol. Its IUPAC name is 4-piperazin-1-yl-6,7-dihydrothieno[3,2-d]pyrimidine.
| Compound Name | 4-piperazin-1-yl-6,7-dihydrothieno[3,2-d]pyrimidine |
|---|---|
| PubChem CID | 86686511 |
| Molecular Formula | C10H14N4S |
| Molecular Weight | 222.32 g/mol |
| Exact Mass | 222.09 |
| IUPAC Name | 4-piperazin-1-yl-6,7-dihydrothieno[3,2-d]pyrimidine |
| SMILES | c1nc2c(c(N3CCNCC3)n1)SCC2 |
| InChI | InChI=1S/C10H14N4S/c1-6-15-9-8(1)12-7-13-10(9)14-4-2-11-3-5-14/h7,11H,1-6H2 |
| InChIKey | UKKOTBDJCKNZJQ-UHFFFAOYSA-N |
| XLogP | 0.53 |
| TPSA | 41.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.32 |
| LogP ≤ 5 | 0.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |