C10H16Cl2N6 — CID 19969708
8-methyl-6-piperazin-1-yl-7H-purine;dihydrochloride (PubChem CID 19969708) has the molecular formula C10H16Cl2N6 and a molecular weight of 291.19 g/mol. Its IUPAC name is 8-methyl-6-piperazin-1-yl-7H-purine;dihydrochloride.
| Compound Name | 8-methyl-6-piperazin-1-yl-7H-purine;dihydrochloride |
|---|---|
| PubChem CID | 19969708 |
| Molecular Formula | C10H16Cl2N6 |
| Molecular Weight | 291.19 g/mol |
| Exact Mass | 290.08 |
| IUPAC Name | 8-methyl-6-piperazin-1-yl-7H-purine;dihydrochloride |
| SMILES | Cc1nc2ncnc(N3CCNCC3)c2[nH]1.Cl.Cl |
| InChI | InChI=1S/C10H14N6.2ClH/c1-7-14-8-9(15-7)12-6-13-10(8)16-4-2-11-3-5-16;;/h6,11H,2-5H2,1H3,(H,12,13,14,15);2*1H |
| InChIKey | VPBARBSMUSJOOA-UHFFFAOYSA-N |
| XLogP | 0.91 |
| TPSA | 69.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.19 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |