C13H23NO2 — CID 139404659
(E)-5-[[(E)-but-1-enyl]amino]-4-methyl-2-propan-2-ylpent-4-enoic acid (PubChem CID 139404659) has the molecular formula C13H23NO2 and a molecular weight of 225.33 g/mol. Its IUPAC name is (E)-5-[[(E)-but-1-enyl]amino]-4-methyl-2-propan-2-ylpent-4-enoic acid.
| Compound Name | (E)-5-[[(E)-but-1-enyl]amino]-4-methyl-2-propan-2-ylpent-4-enoic acid |
|---|---|
| PubChem CID | 139404659 |
| Molecular Formula | C13H23NO2 |
| Molecular Weight | 225.33 g/mol |
| Exact Mass | 225.17 |
| IUPAC Name | (E)-5-[[(E)-but-1-enyl]amino]-4-methyl-2-propan-2-ylpent-4-enoic acid |
| SMILES | CC/C=C/N/C=C(\C)CC(C(=O)O)C(C)C |
| InChI | InChI=1S/C13H23NO2/c1-5-6-7-14-9-11(4)8-12(10(2)3)13(15)16/h6-7,9-10,12,14H,5,8H2,1-4H3,(H,15,16)/b7-6+,11-9+ |
| InChIKey | JYPQJXBKDQMQEL-RXUIJTJXSA-N |
| XLogP | 3.15 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.33 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |