4,5-dichloro-2-propan-2-ylpent-4-enoic acid

C8H12Cl2O2 — CID 54162996

IUPAC4,5-dichloro-2-propan-2-ylpent-4-enoic acid
SMILESCC(C)C(CC(Cl)=CCl)C(=O)O
InChIInChI=1S/C8H12Cl2O2/c1-5(2)7(8(11)12)3-6(10)4-9/h4-5,7H,3H2,1-2H3,(H,11,12)
InChIKeyOPSMIKPBVOBEFF-UHFFFAOYSA-N
MW211.09 g/mol
LogP3.05
Rot. Bonds4

About 4,5-dichloro-2-propan-2-ylpent-4-enoic acid

4,5-dichloro-2-propan-2-ylpent-4-enoic acid (PubChem CID 54162996) has the molecular formula C8H12Cl2O2 and a molecular weight of 211.09 g/mol. Its IUPAC name is 4,5-dichloro-2-propan-2-ylpent-4-enoic acid.

Molecular Properties

Compound Name4,5-dichloro-2-propan-2-ylpent-4-enoic acid
PubChem CID54162996
Molecular FormulaC8H12Cl2O2
Molecular Weight211.09 g/mol
Exact Mass210.02
IUPAC Name4,5-dichloro-2-propan-2-ylpent-4-enoic acid
SMILESCC(C)C(CC(Cl)=CCl)C(=O)O
InChIInChI=1S/C8H12Cl2O2/c1-5(2)7(8(11)12)3-6(10)4-9/h4-5,7H,3H2,1-2H3,(H,11,12)
InChIKeyOPSMIKPBVOBEFF-UHFFFAOYSA-N
XLogP3.05
TPSA37.30 Ų
H-Bond Donors1
H-Bond Acceptors1
Rotatable Bonds4
Heavy Atoms12
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500211.09
LogP ≤ 53.05
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 101

Analyze 4,5-dichloro-2-propan-2-ylpent-4-enoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 4,5-dichloro-2-propan-2-ylpent-4-enoic acid?
The IUPAC name of 4,5-dichloro-2-propan-2-ylpent-4-enoic acid (CID 54162996) is 4,5-dichloro-2-propan-2-ylpent-4-enoic acid.
What is the SMILES notation for 4,5-dichloro-2-propan-2-ylpent-4-enoic acid?
The canonical SMILES for 4,5-dichloro-2-propan-2-ylpent-4-enoic acid is CC(C)C(CC(Cl)=CCl)C(=O)O.
What is the InChIKey of 4,5-dichloro-2-propan-2-ylpent-4-enoic acid?
The InChIKey is OPSMIKPBVOBEFF-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H12Cl2O2/c1-5(2)7(8(11)12)3-6(10)4-9/h4-5,7H,3H2,1-2H3,(H,11,12).
What are the key properties of 4,5-dichloro-2-propan-2-ylpent-4-enoic acid?
4,5-dichloro-2-propan-2-ylpent-4-enoic acid has a molecular weight of 211.09 g/mol, XLogP of 3.05, 4 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4,5-dichloro-2-propan-2-ylpent-4-enoic acid is sourced from PubChem (CID 54162996), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).