C31H52O3 — CID 139407037
(1S,3R,4R)-1-[2-[(1R,4aR,4bR,7S,10aR)-7-hydroxy-1,2,4b,8,8,10a-hexamethyl-4,4a,5,6,7,8a,9,10-octahydrophenanthren-1-yl]ethyl]-3,4-dimethylcyclohexane-1-carboxylic acid (PubChem CID 139407037) has the molecular formula C31H52O3 and a molecular weight of 472.75 g/mol. Its IUPAC name is (1S,3R,4R)-1-[2-[(1R,4aR,4bR,7S,10aR)-7-hydroxy-1,2,4b,8,8,10a-hexamethyl-4,4a,5,6,7,8a,9,10-octahydrophenanthren-1-yl]ethyl]-3,4-dimethylcyclohexane-1-carboxylic acid.
| Compound Name | (1S,3R,4R)-1-[2-[(1R,4aR,4bR,7S,10aR)-7-hydroxy-1,2,4b,8,8,10a-hexamethyl-4,4a,5,6,7,8a,9,10-octahydrophenanthren-1-yl]ethyl]-3,4-dimethylcyclohexane-1-carboxylic acid |
|---|---|
| PubChem CID | 139407037 |
| Molecular Formula | C31H52O3 |
| Molecular Weight | 472.75 g/mol |
| Exact Mass | 472.39 |
| IUPAC Name | (1S,3R,4R)-1-[2-[(1R,4aR,4bR,7S,10aR)-7-hydroxy-1,2,4b,8,8,10a-hexamethyl-4,4a,5,6,7,8a,9,10-octahydrophenanthren-1-yl]ethyl]-3,4-dimethylcyclohexane-1-carboxylic acid |
| SMILES | CC1=CC[C@@H]2[C@@]3(C)CC[C@H](O)C(C)(C)C3CC[C@@]2(C)[C@]1(C)CC[C@@]1(C(=O)O)CC[C@@H](C)[C@H](C)C1 |
| InChI | InChI=1S/C31H52O3/c1-20-11-16-31(26(33)34,19-21(20)2)18-17-29(7)22(3)9-10-24-28(6)14-13-25(32)27(4,5)23(28)12-15-30(24,29)8/h9,20-21,23-25,32H,10-19H2,1-8H3,(H,33,34)/t20-,21-,23?,24-,25+,28+,29-,30-,31+/m1/s1 |
| InChIKey | XJRQTKINDVUNNT-QCTYWQQJSA-N |
| XLogP | 7.87 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.75 |
| LogP ≤ 5 | 7.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|