C26H33F2N3O — CID 139407652
1-[2-[(1R,3S,5R,6S,7S,10R,11S,14S,16R)-4,4-difluoro-7,14-dimethyl-6-pentacyclo[8.8.0.02,7.03,5.011,16]octadecanyl]-2-oxoethyl]pyrazole-4-carbonitrile (PubChem CID 139407652) has the molecular formula C26H33F2N3O and a molecular weight of 441.57 g/mol. Its IUPAC name is 1-[2-[(1R,3S,5R,6S,7S,10R,11S,14S,16R)-4,4-difluoro-7,14-dimethyl-6-pentacyclo[8.8.0.02,7.03,5.011,16]octadecanyl]-2-oxoethyl]pyrazole-4-carbonitrile.
| Compound Name | 1-[2-[(1R,3S,5R,6S,7S,10R,11S,14S,16R)-4,4-difluoro-7,14-dimethyl-6-pentacyclo[8.8.0.02,7.03,5.011,16]octadecanyl]-2-oxoethyl]pyrazole-4-carbonitrile |
|---|---|
| PubChem CID | 139407652 |
| Molecular Formula | C26H33F2N3O |
| Molecular Weight | 441.57 g/mol |
| Exact Mass | 441.26 |
| IUPAC Name | 1-[2-[(1R,3S,5R,6S,7S,10R,11S,14S,16R)-4,4-difluoro-7,14-dimethyl-6-pentacyclo[8.8.0.02,7.03,5.011,16]octadecanyl]-2-oxoethyl]pyrazole-4-carbonitrile |
| SMILES | C[C@H]1CC[C@H]2[C@H](CCC3C4[C@H]5[C@@H]([C@H](C(=O)Cn6cc(C#N)cn6)[C@@]4(C)CC[C@@H]32)C5(F)F)C1 |
| InChI | InChI=1S/C26H33F2N3O/c1-14-3-5-17-16(9-14)4-6-19-18(17)7-8-25(2)21(19)23-24(26(23,27)28)22(25)20(32)13-31-12-15(10-29)11-30-31/h11-12,14,16-19,21-24H,3-9,13H2,1-2H3/t14-,16+,17-,18+,19?,21?,22-,23-,24+,25-/m0/s1 |
| InChIKey | XCLXDWNEPQBRQJ-MJQMVGPWSA-N |
| XLogP | 5.33 |
| TPSA | 58.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.57 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |