C23H32F2N4O — CID 139407681
1-[(1R,3S,5R,6S,7S,11S,14S,16R)-4,4-difluoro-7,14-dimethyl-6-pentacyclo[8.8.0.02,7.03,5.011,16]octadecanyl]-2-(tetrazol-2-yl)ethanone (PubChem CID 139407681) has the molecular formula C23H32F2N4O and a molecular weight of 418.53 g/mol. Its IUPAC name is 1-[(1R,3S,5R,6S,7S,11S,14S,16R)-4,4-difluoro-7,14-dimethyl-6-pentacyclo[8.8.0.02,7.03,5.011,16]octadecanyl]-2-(tetrazol-2-yl)ethanone.
| Compound Name | 1-[(1R,3S,5R,6S,7S,11S,14S,16R)-4,4-difluoro-7,14-dimethyl-6-pentacyclo[8.8.0.02,7.03,5.011,16]octadecanyl]-2-(tetrazol-2-yl)ethanone |
|---|---|
| PubChem CID | 139407681 |
| Molecular Formula | C23H32F2N4O |
| Molecular Weight | 418.53 g/mol |
| Exact Mass | 418.25 |
| IUPAC Name | 1-[(1R,3S,5R,6S,7S,11S,14S,16R)-4,4-difluoro-7,14-dimethyl-6-pentacyclo[8.8.0.02,7.03,5.011,16]octadecanyl]-2-(tetrazol-2-yl)ethanone |
| SMILES | C[C@H]1CC[C@@H]2C3CC[C@@]4(C)C(C3CC[C@@H]2C1)[C@H]1[C@@H]([C@@H]4C(=O)Cn2ncnn2)C1(F)F |
| InChI | InChI=1S/C23H32F2N4O/c1-12-3-5-14-13(9-12)4-6-16-15(14)7-8-22(2)18(16)20-21(23(20,24)25)19(22)17(30)10-29-27-11-26-28-29/h11-16,18-21H,3-10H2,1-2H3/t12-,13+,14-,15?,16?,18?,19-,20-,21+,22-/m0/s1 |
| InChIKey | IRFCTJGFXOVKMZ-JIVJOCIXSA-N |
| XLogP | 4.25 |
| TPSA | 60.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.53 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |