C24H40N4O — CID 167106524
N,N'-diamino-N-[2-(7,14-dimethyl-6-pentacyclo[8.8.0.02,7.03,5.011,16]octadecanyl)-2-oxoethyl]ethanimidamide (PubChem CID 167106524) has the molecular formula C24H40N4O and a molecular weight of 400.61 g/mol. Its IUPAC name is N,N'-diamino-N-[2-(7,14-dimethyl-6-pentacyclo[8.8.0.02,7.03,5.011,16]octadecanyl)-2-oxoethyl]ethanimidamide.
| Compound Name | N,N'-diamino-N-[2-(7,14-dimethyl-6-pentacyclo[8.8.0.02,7.03,5.011,16]octadecanyl)-2-oxoethyl]ethanimidamide |
|---|---|
| PubChem CID | 167106524 |
| Molecular Formula | C24H40N4O |
| Molecular Weight | 400.61 g/mol |
| Exact Mass | 400.32 |
| IUPAC Name | N,N'-diamino-N-[2-(7,14-dimethyl-6-pentacyclo[8.8.0.02,7.03,5.011,16]octadecanyl)-2-oxoethyl]ethanimidamide |
| SMILES | C/C(=N/N)N(N)CC(=O)C1C2CC2C2C3CCC4CC(C)CCC4C3CCC12C |
| InChI | InChI=1S/C24H40N4O/c1-13-4-6-16-15(10-13)5-7-18-17(16)8-9-24(3)22(18)19-11-20(19)23(24)21(29)12-28(26)14(2)27-25/h13,15-20,22-23H,4-12,25-26H2,1-3H3/b27-14- |
| InChIKey | NBAKOSYQEPXHGA-VYYCAZPPSA-N |
| XLogP | 3.78 |
| TPSA | 84.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.61 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|